I-BRD9
BRD9 inhibitor Chromatin/Epigenetics|Bromodomain
| Catalog Number | B6169-1 |
| Research Area | Chromatin/Epigenetics|Bromodomain |
| Molecular Formula | C22H22F3N3O3S2 |
| CAS# | 1714146-59-4 |
| Purity | 98% |
| SMILES | N=C(C(S1)=CC2=C1C(C3=CC=CC(C(F)(F)F)=C3)=CN(CC)C2=O)NC(CC4)CCS4(=O)=O |
| Size | 1mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B6169 |
