O-Benzyl Posaconazole
Intermediates
| Trivial name | NULL |
| Catalog Number | CS-T-49044 |
| Alternative Name(s) | O-Benzyl Posaconazole;Benzylated Posaconazole Impurity;2,5-Anhydro-1,3,4-trideoxy4-[1-[(1S,2S)-1-ethyl-2-(phenylmethoxy)propyl]-1,5-dihydro-5-oxo-4H-1,2,4-triazol-4-yl]phenyl]-1-piperazinyl]phenoxy]methyl]-1-(1H-1,2,4-triazol-1-yl)-D-threo-pentitol; |
| Research Area | Precursor to the fungicide, Posaconazole. |
| Molecular Formula | C44H48F2N8O4 |
| CAS# | 170985-86-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | FC1=C(C=CC(F)=C1)[C@]2(C[C@H](COC3=CC=C(N4CCN(C5=CC=C(N(C=NN6[C@@H](CC)[C@H](C)OCC7=CC=CC=C7)C6=O)C=C5)CC4)C=C3)CO2)CN8C=NC=N8 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST49044.html |
| Additional Information | NULL |