SC 236
SC-236 is an orally active inhibitor of COX-2. SC-236 displays anti-inflammatory properties and potent antimetastatic activity against both experimental metastases and spontaneous metastases arising following primary tumor excision.
| Trivial name | / |
| Catalog Number | CSN23106 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C16H11ClF3N3O2S |
| CAS# | 170569-86-5 |
| Purity | ≥99% |
| SMILES | O=S(C1=CC=C(N2N=C(C(F)(F)F)C=C2C3=CC=C(Cl)C=C3)C=C1)(N)=O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/sc-236.html |