(+)-Dibenzoyl-D-tartaric acid | MedChemExpress (MCE)
(+)-Dibenzoyl-D-tartaric acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
Trivial name | (+)-Dibenzoyl-D-tartaric acid |
Catalog Number | HY-20551 |
Research Area | Others |
CAS# | 17026-42-5 |
Purity | 99.50% |
SMILES | O=C(O)[C@@H](OC(C1=CC=CC=C1)=O)[C@H](OC(C2=CC=CC=C2)=O)C(O)=O |
PubChem Chemical Structure ID | 1550213 |
Size | 10 mM * 1 mL |
Supplier Page | https://www.medchemexpress.com/plus-dibenzoyl-d-tartaric-acid.html |