Nepicastat (SYN-117) HCl
Nepicastat (SYN-117) HCl is a potent and selective inhibitor of both bovine and human dopamine-β-hydroxylase with IC50 of 8.5 nM and 9 nM, with negligible affinity for twelve other enzymes and thirteen neurotransmitter receptors. Phase 2.
| Trivial name | N/A |
| Catalog Number | S2695 |
| Molecular Formula | C34H36Cl2N8O4 |
| CAS# | 170151-24-3 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | COC1=CC(=C(Cl)C(=C1Cl)NC(=O)N(CC2=CC=C(NC(=O)C=C)C=C2)C3=NC=NC(=C3)NC4=CC=C(C=C4)N5CCN(C)CC5)OC |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/nepicastat-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/nepicastat-hydrochloride-chemical-structure-s2695.gif |