Alvimopan dihydrate (LY246736 dihydrate)
Alvimopan (LY-246736) is a potent, relatively nonselective opioid antagonist with Ki values of 0.77, 4.4, and 40 nM for the μ, δ, and κ opioid receptors, respectively, displaying >100-fold selectivity over other aminergic G-protein-coupled receptors.
| Trivial name | N/A |
| Catalog Number | S5701 |
| Molecular Formula | C21H25N5O2 |
| CAS# | 170098-38-1 |
| SMILES | CC1CN(CC(C)O1)C2=CC(=NC=N2)C3=N[NH]C4=CC=C(OC5(C)CC5)C=C34 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/alvimopan-dihydrate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/alvimopan-dihydrate-chemical-structure-s5701.gif |
