Clonazepam D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-T-57147 |
| Alternative Name(s) | Landsen-d4;Rivotril-d4;50tro-2H-1,4-benzodiazepin-2-one; Ro-5-4023-dorivil-d4; Klonopin-d4; Landsen-d4; Rivotril-d4; |
| Research Area | Labelled Clonazepam . Antiepileptic agent with anxiolytic and antimanic properties. Anticonvulsant. |
| Molecular Formula | C15H6D4ClN3O3 |
| CAS# | 170082-15-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[N](C1=CC=C(N2)C(C(C(C([2H])=C3[2H])=C(C([2H])=C3[2H])Cl)=NCC2=O)=C1)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST57147.html |
| Additional Information | NULL |