LY333531 HCl
LY333531 is a β-specific protein kinase C inhibitor. It competitively and reversibly inhibits PKCβ1 and PKCβ2 with IC50 values of 4.7 and 5.9 nM respectively.
| Trivial name | Ruboxistaurin; Ruboxistaurin HCl |
| Catalog Number | CSN12991 |
| Alternative Name(s) | Ruboxistaurin; Ruboxistaurin HCl |
| Research Area | Metabolic Disease |
| Molecular Formula | C28H29ClN4O3 |
| CAS# | 169939-93-9 |
| Purity | ≥98% |
| SMILES | O=C1NC(C(C2=CN(C3=CC=CC=C32)CCO[C@H](CN(C)C)CC4)=C1C5=CN4C6=CC=CC=C56)=O.[H]Cl |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/ly333531-hcl.html |