(S)-Reticuline 5mg
(S)-Reticuline is the (S)-enantiomer of Reticuline. An enantiomer of a tetrahydrobenzylisoquinoline alkaloid. Reticuline is a chemical compound found in a variety of plants including Lindera aggregata, Annona squamosa, and Ocotea fasciculata.
| Trivial name | (S)-Reticuline 5mg |
| Catalog Number | A13830-5 |
| Alternative Name(s) | 1,2,3,4-tetrahydro-1-[(3-hydroxy-4-methoxyphenyl)methyl]-6-methoxy-2-methyl- |
| Molecular Formula | C19H23NO4 |
| CAS# | 1699-46-3 |
| SMILES | CN1CCC2=CC(=C(C=C2[C@@H]1CC3=CC(=C(C=C3)OC)O)O)OC |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/s-reticuline.html |
