Celecoxib
API Standard
| Catalog Number | CS-O-01154 |
| Alternative Name(s) | 4-[5-(4-Methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| Research Area | Celecoxib is a selective Cox-2 inhibitor (IC50of 40 nM). Celecoxib shows low sensitivity against Cox-1 (IC50 of 15 μM). Celecoxib shows an anti-proliferative effect on nasopharyngeal carcinoma (NPC) cell lines including HNE1 (IC50of 32.86 μM) and CNE1-LM |
| Molecular Formula | C17H14F3N3O2S |
| CAS# | 169590-42-5 |
| Purity | >98% |
| SMILES | FC(F)(C1=NN(C2=CC=C([S](N)(=O)=O)C=C2)C(C3=CC=C(C)C=C3)=C1)F |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01154.html |