Celecoxib 10mM * 1mL in DMSO
Celecoxib is a sulfa non-steroidal anti-inflammatory drug (NSAID) and selective COX-2 inhibitor used in the treatment of osteoarthritis, rheumatoid arthritis, acute pain, painful menstruation and menstrual symptoms, and to reduce numbers of colon and rectum polyps in patients with familial adenomatous polyposis.
| Trivial name | Celecoxib 10mM * 1mL in DMSO |
| Catalog Number | A10193-10mM-D |
| Alternative Name(s) | 4-[5-(4-methylphenyl)-3-(trifluoromethyl) pyrazol-1-yl]benzenesulfonamide |
| Molecular Formula | C17H14F3N3O2S |
| CAS# | 169590-42-5 |
| SMILES | CC1=CC=C(C=C1)C2=CC(=NN2C3=CC=C(C=C3)S(=O)(=O)N)C(F)(F)F |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/celecoxib.html |