I-191
I-191 is a potent PAR2 antagonist that inhibits multiple PAR2-induced signaling pathways and functional responses. I-191 also inhibits ERK1/2 phosphorylation, RhoA activation, and inhibition of forskolin-stimulated cAMP accumulation induced by micromolar concentrations of biased ligand GB88.
| Trivial name | N/A |
| Catalog Number | E0102 |
| Molecular Formula | C₂₃H₂₆FN₅O₂ |
| CAS# | 1690172-25-8 |
| SMILES | CC(C)(C)C1=CC(=N[N]2C=C(N=C12)C(=O)N3CCNC(=O)C3(C)C)C4=CC=C(F)C=C4 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/i-191.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e0102-i-191-chemical-structure.gif |