Tyrphostin AG1433
Tyrphostin AG1433 is a tyrosine kinases inhibitor and also a selective PDGFRβ and VEGFR-2 (Flk-1/KDR) inhibitor with IC50s of 5.0 μM and 9.3 μM, respectively.
| Trivial name | SU1433 |
| Catalog Number | CSN25326 |
| Alternative Name(s) | SU1433 |
| Research Area | Cancer |
| Molecular Formula | C16H14N2O2 |
| CAS# | 168835-90-3 |
| Purity | ≥98% |
| SMILES | OC1=CC=C(C2=NC3=CC(C)=C(C)C=C3N=C2)C=C1O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/tyrphostin-ag1433.html |