Fosbretabulin disodium (CA4P) 50mg
Fosbretabulin disodium is the disodium salt of a water-soluble phosphate derivative of a natural stilbenoid phenol derived from the African bush willow (Combretum caffrum) with potential vascular disrupting and antineoplastic activities.
| Trivial name | Fosbretabulin disodium (CA4P) 50mg |
| Catalog Number | A13081-50 |
| Alternative Name(s) | Disodium [2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] phosphate |
| Molecular Formula | C18H19Na2O8P |
| CAS# | 168555-66-6, 222030-63-9 |
| SMILES | COC1=C(C=C(C=C1)/C=CC2=CC(=C(C(=C2)OC)OC)OC)OP(=O)([O-])[O-].[Na+].[Na+] |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/fosbretabulin-disodium-ca4p.html |