(1S)-CCR2 antagonist 1 | MedChemExpress (MCE)
(1S)-CCR2 antagonist 1 is a left-handed chiral body of CCR2 antagonist 1 (HY-112792). CCR2 antagonist 1 is a high-affinity and long-residence-time CCR2 antagonist, with a Ki of 2.4 nM[1].
| Trivial name | (1S)-CCR2 antagonist 1 |
| Catalog Number | HY-112792A |
| Research Area | Endocrinology |
| CAS# | 1683534-97-5 |
| Purity | 98.03% |
| SMILES | O=C([C@]1(C(C)C)C[C@H](N[C@H]2CCC3=C2C=CC(Br)=C3)CC1)N4CC5=C(C=CC(C(F)(F)F)=C5)CC4 |
| PubChem Chemical Structure ID | 118734690 |
| Size | 50 mg |
| Supplier Page | https://www.medchemexpress.com/1s-ccr2-antagonist-1.html |