T-(S)-GNA Phosphoramidite
T-(S)-GNA phosphoramidite is a crucial building block in the synthesis of oligonucleotides used to treat various diseases such as cancer, viral infections, and genetic disorders. It is used to specifically modify the nucleotides of the oligonucleotide, enhancing its therapeutic potential and specificity. By utilizing this product, researchers can improve the efficacy and selectivity of their oligonucleotide-based therapies.
Catalog Number | PIPB-0340 |
Alternative Name(s) | MFCD32215176 SY312662 (S)-1-(4, 4 inverted exclamation mark -Dimethoxytrityl)-3-thymidine-2-cyanoethylphosphoramidite |
Research Area | Phosphoramidites Series |
Molecular Formula | C38H47N4O7P |
CAS# | 168332-13-6 |
SMILES | CC1=CN(C(=O)NC1=O)CC(COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)OP(N(C(C)C)C(C)C)OCCC#N |
Size | inquiry |
Supplier Page | https://www.protheragen-ing.com/t-s-gna-phosphoramidite-item-10458.html |