Asiaticoside
Asiaticoside, a natural product isolated and purified from the herbs of Centella asiatica (L.) Urban with antioxidant, anti-inflammatory, antipyretic, anxiolytic-like, antidepressant-like, hepatoprotective and significant wound healing activity, suppresses collagen expression and TGF-β/Smad signaling through inducing Smad7 and inhibiting TGF-βRI and TGF-βRII in keloid fibroblasts, and is a biochemical modulator that induce apoptosis.
| Trivial name | Ba 2742; BRN0078195; CCRIS8995; NSC166062; Emdecassol,Madecassol |
| Catalog Number | CSN19487 |
| Alternative Name(s) | Ba 2742; BRN0078195; CCRIS8995; NSC166062; Emdecassol,Madecassol |
| Research Area | / |
| Molecular Formula | C48H78O19 |
| CAS# | 16830-15-2 |
| Purity | ≥98% |
| SMILES | C[C@@H]1CC[C@@]2(C(O[C@@H]3O[C@H](CO[C@H]4[C@H](O)[C@@H](O)[C@H](O[C@@]5([H])[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O5)[C@@H](CO)O4)[C@@H](O)[C@H](O)[C@H]3O)=O)[C@@](C6=CC[C@@]([C@](C[C@@H](O)[C@H](O)[C@]7(CO)C)(C)[C@@]7([H])CC8)([H])[C@]8(C)[C@]6(C)CC2)([H])[C@H]1C |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/asiaticoside.html |
