NXY-059 (Cerovive) 10mM * 1mL in DMSO
NXY-059 is the disulfonyl derivative of the neuroprotective spin trap pheny lbutynitrone or “PBN” with free radical-trapping properties. It substantially lessens the functional disability resulting from cerebral ischemia in a primate species.
Trivial name | NXY-059 (Cerovive) 10mM * 1mL in DMSO |
Catalog Number | A10663-10mM-D |
Alternative Name(s) | Disodium 4-[(Z)-(tert-butyl-oxidoazaniumylidene)methyl]benzene-1,3-disulfonate |
Molecular Formula | C11H13NNa2O7S2 |
CAS# | 168021-79-2 |
SMILES | CC(C)(C)/[N+](=C/C1=C(C=C(C=C1)S(=O)(=O)[O-])S(=O)(=O)[O-])/[O-].[Na+].[Na+] |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/nxy-059-cerovive.html |