PD98059
PD98059 is a non-ATP competitive MEK inhibitor with IC50 of 2 μM in a cell-free assay, specifically inhibits MEK-1-mediated activation of MAPK; does not directly inhibit ERK1 or ERK2. PD98059 is a ligand for the aryl hydrocarbon receptor (AHR) and functions as an AHR antagonist.
| Trivial name | N/A |
| Catalog Number | S1177 |
| Molecular Formula | C19H14F3N3O3 |
| CAS# | 167869-21-8 |
| SMILES | CC1=NOC(=C1)C(=O)NC2=CC=CC(=C2)C(=O)NC3=CC=CC(=C3)C(F)(F)F |
| Size | 10mg |
| Supplier Page | http://www.selleckchem.com/products/PD-98059.html |
| Additional Information | https://file.selleck.cn/downloads/struct/PD98059-chemical-structure-S1177.gif |