(19R)-13-Deoxy-19-hydroxyenmein | MedChemExpress (MCE)
(19R)-13-Deoxy-19-hydroxyenmein is the parent compound of enmein-type diterpenoid analogs. (19R)-13-Deoxy-19-hydroxyenmein has anti-proliferative activities with IC50 values of 0.41, 0.85, 0.43, 1.89 μM against human cancer cell lines K562, MGC-803, CaEs-17, and Bel-7402, respectively[1].
| Trivial name | (19R)-13-Deoxy-19-hydroxyenmein |
| Catalog Number | HY-N12253 |
| Research Area | Cancer |
| CAS# | 16763-48-7 |
| Purity | ≥98.00% |
| SMILES | O[C@H]1[C@@](C2(C)C)([H])[C@]([C@@](CC2)([H])OC3=O)(CO1)[C@@](CC[C@@]4([H])C5=C)([H])[C@]3(C5=O)C4O |
| PubChem Chemical Structure ID | 168679883 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/19r-13-deoxy-19-hydroxyenmein.html |