N-cis-Tetradec-9Z-enoyl-L-homoserine lactone | MedChemExpress (MCE)
N-cis-Tetradec-9Z-enoyl-L-homoserine lactone (C14-9Z-HSL) is an autoinducer in C. rodentium, that serves as signal molecule, coordinates the gene expression and behaviors through diffusion into cells of different bacterial species[1].
| Trivial name | N-cis-Tetradec-9Z-enoyl-L-homoserine lactone |
| Catalog Number | HY-124286 |
| Alternative Name(s) | C14-9Z-HSL |
| Research Area | Inflammation/Immunology |
| CAS# | 1675245-06-3 |
| Purity | ≥98.0% |
| SMILES | CCCC/C=C\CCCCCCCC(N[C@H]1CCOC1=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/n-cis-tetradec-9z-enoyl-l-homoserine-lactone.html |