Clevidipine 10mM * 1mL in DMSO
Clevidipine is a dihydropyridine calcium channel blocker indicated for the reduction of blood pressure when oral therapy is not feasible or not desirable.
| Trivial name | Clevidipine 10mM * 1mL in DMSO |
| Catalog Number | A11746-10mM-D |
| Alternative Name(s) | O3-(butanoyloxymethyl) O5-methyl (4R)- 4-(2,3-dichlorophenyl)-2,6-dimethyl- 1,4-dihydropyridine-3,5-dicarboxylate |
| Molecular Formula | C21H23Cl2NO6 |
| CAS# | 167221-71-8 |
| SMILES | CCCC(=O)OCOC(=O)C1=C(NC(=C(C1C2=C(C(=CC=C2)Cl)Cl)C(=O)OC)C)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/clevidipine.html |
