4-Hydroxyantipyrine (Standard) | MedChemExpress (MCE)
4-Hydroxyantipyrine (Standard) is the analytical standard of 4-Hydroxyantipyrine. This product is intended for research and analytical applications. 4-Hydroxyantipyrine (4-Hydroxyphenazone; NSC 174055) is the major metabolite of Antipyrine (HY-B0171), can be as a biodistribution promoter. 4-Hydroxyantipyrine can increase distribution of concentration ratio of Citicoline and Antipyrine in the brain[1][2].
| Trivial name | 4-Hydroxyantipyrine (Standard) |
| Catalog Number | HY-B2150R |
| Alternative Name(s) | 4-Hydroxyphenazone (Standard); NSC 174055 (Standard) |
| Research Area | Others |
| CAS# | 1672-63-5 |
| Purity | ≥98.0% |
| SMILES | O=C1N(C2=CC=CC=C2)N(C)C(C)=C1O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/4-hydroxyantipyrine-standard.html |