3,6-Di-2-pyridyl-1,2,4,5-tetrazine
3,6-Di-2-pyridyl-1,2,4,5-tetrazine undergoes solid-state reaction with fullerene C60 by high-speed vibration milling technique. It acts as electron-deficient diene in the inverse electron demand Diels Alder reaction. 3,6-Di-2-pyridyl-1,2,4,5-tetrazine (DPTZ) undergoes solvothermal reaction with CuSO4. 6H2O and Cu(Ac)2. H2O to afford copper containing coordination polymers. It reacts with enamine derivative of morpholine and 5-,6-,7- and 8-membered cyclic ketones to afford pyridazine derivatives.
Catalog Number | CBB1113715 |
Molecular Formula | C12H8N6 |
CAS# | 1671-87-0 |
Purity | >96% |
Inchi | 1S/C12H8N6/c1-3-7-13-9(5-1)11-15-17-12(18-16-11)10-6-2-4-8-14-10/h1-8H |
Inchi Key | JFBIRMIEJBPDTQ-UHFFFAOYSA-N |
SMILES | c1ccc(nc1)-c2nnc(nn2)-c3ccccn3 |
Size | Inquiry |
Supplier Page | https://www.amerigoscientific.com/36-di-2-pyridyl-1245-tetrazine-item-113715.html |