Naltrexone HCl 10mM * 1mL in DMSO
Naltrexone is an opioid receptor antagonist used primarily in the management of alcohol dependence and opioid dependence.
| Trivial name | Naltrexone HCl 10mM * 1mL in DMSO |
| Catalog Number | A11723-10mM-D |
| Alternative Name(s) | N/A |
| Molecular Formula | C20H23NO4.HCl |
| CAS# | 16676-29-2 |
| SMILES | C1CC1CN2CC[C@]34[C@@H]5C(=O)CC[C@]3([C@H]2CC6=C4C(=C(C=C6)O)O5)O.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/naltrexone-hcl.html |
