Anidulafungin
Anidulafungin is an echinocandin antifungal agent used to treat invasive Aspergillus infection, working by inhibiting (1→3)-β-D-glucan synthase, an enzyme important to the synthesis of the fungal cell wall.
| Trivial name | LY303366 |
| Catalog Number | CSN17992 |
| Alternative Name(s) | LY303366 |
| Research Area | Infection |
| Molecular Formula | C58H73N7O17 |
| CAS# | 166663-25-8 |
| Purity | ≥99% |
| SMILES | OC1CC(C(NC(C(NC(C(N2C(C(NC(C(CC(C(NC(C3=O)C(C)O)=O)NC(C4=CC=C(C=C4)C5=CC=C(C=C5)C6=CC=C(C=C6)OCCCCC)=O)O)O)=O)C(C(C2)C)O)=O)C(O)C)=O)C(C(C7=CC=C(C=C7)O)O)O)=O)N3C1 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/anidulafungin.html |
