Acetic Anhydride D6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-10852 |
| Alternative Name(s) | Hexadeu'-Anhydride Acetic-2,2,2-d3 Acid; |
| Research Area | Acetic Anhydride-d6 is the labeled analog of acetic anhydride, a reagent used generally in acetylation reactions in organic chemistry, primarily cellulose acetate and film material. |
| Molecular Formula | C4D6O3 |
| CAS# | 16649-49-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C([2H])([2H])[2H])OC(C([2H])([2H])[2H])=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10852.html |
| Additional Information | NULL |