LPA5 antagonist 3 | MedChemExpress (MCE)
LPA5 antagonist 3 (Example 74) is a lysophosphatidic acid receptor 5 (LPA5) antagonist, with an IC50 of 170 nM. LPA5 antagonist 3 can be used for the research of pain disorders and atherosclerosis[1].
| Trivial name | LPA5 antagonist 3 |
| Catalog Number | HY-160616 |
| Research Area | Neurological Disease; Cardiovascular Disease |
| CAS# | 1664336-44-0 |
| Purity | ≥98.0% |
| SMILES | O=C(C1=CC=C(CN(CC(F)(C)F)C(C2=CC=C(C=C2)OC3=C(F)C=CC=C3)=O)C=C1)O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lpa5-antagonist-3.html |