Zoledronic acid monohydrate
Zoledronic acid (Zoledronate, CGP-4244) monohydrate, a nitrogen-containing bisphosphonate, is a potent osteoclast inhibitor which induces apoptosis in osteoclasts by inhibiting enzymes of the mevalonate pathway and preventing the isoprenylation of small GTP-binding proteins such as Ras and Rho.
| Trivial name | zoledronate monohydrate, CGP-4244 monohydrate |
| Catalog Number | S5244 |
| Molecular Formula | C5H10N2O7P2.H2O |
| CAS# | 165800-06-6 |
| Inchi | InChI=1S/C5H10N2O7P2.H2O/c8-5(15(9,10)11,16(12,13)14)3-7-2-1-6-4-7;/h1-2,4,8H,3H2,(H2,9,10,11)(H2,12,13,14);1H2 |
| Inchi Key | FUXFIVRTGHOMSO-UHFFFAOYSA-N |
| SMILES | C1=CN(C=N1)CC(O)(P(=O)(O)O)P(=O)(O)O.O |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/zoledronic-acid-monohydrate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/zoledronic-acid-monohydrate-chemical-structure-s5244.gif |