Urolithin C
Urolithin C, a gut-microbial metabolite of Ellagic acid, is a glucose-dependent activator of insulin secretion. Urolithin C is a L-type Ca2+ channel opener and enhances Ca2+ influx. Urolithin C induces cell apoptosis through a mitochondria-mediated pathway and also stimulates reactive oxygen species (ROS) formation.
| Catalog Number | E7884 |
| Molecular Formula | C29H43NO4S |
| CAS# | 165393-06-6 |
| Inchi | InChI=1S/C29H43NO4S/c1-17(2)22-14-25(20(7)8)27(26(15-22)21(9)10)16-28(31)30-35(32,33)34-29-23(18(3)4)12-11-13-24(29)19(5)6/h11-15,17-21H,16H2,1-10H3,(H,30,31) |
| Inchi Key | PTQXTEKSNBVPQJ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC=C1)C(C)C)OS(=O)(=O)NC(=O)CC2=C(C=C(C=C2C(C)C)C(C)C)C(C)C |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/urolithin-c.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e7884-urolithin-c-chemical-structure-tube.png |