AZ6102
TNKS1/2 inhibitor DNA Damage/DNA Repair|tankyrase
| Catalog Number | B6162-25 |
| Research Area | DNA Damage/DNA Repair|tankyrase |
| Molecular Formula | C25H28N6O |
| CAS# | 1645286-75-4 |
| Purity | 98% |
| SMILES | O=C1NC(C2=CC=C(C3=CN=C(N4C[C@H](C)N[C@H](C)C4)C=C3C)C=C2)=NC5=C1C=CN5C |
| Size | 25mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B6162 |
