KIO-301 chloride | MedChemExpress (MCE)
KIO-301 chloride is an azobenzene photoswitch compound that can block voltage-gated ion channels, including hyperpolarisation-activated cyclic nucleotide-gated (HCN) and voltage-gated potassium channels during exposure to visible light[1].
| Trivial name | KIO-301 chloride |
| Catalog Number | HY-161092 |
| Research Area | Neurological Disease |
| CAS# | 1643463-59-5 |
| Purity | ≥98.00% |
| SMILES | O=C(C[N+](CC)(CC)CC)NC(C=C1)=CC=C1/N=N/C2=CC=C(N(CC3=CC=CC=C3)CC)C=C2.[Cl-] |
| PubChem Chemical Structure ID | 169494537 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kio-301-chloride.html |