Longiferone B | MedChemExpress (MCE)
Longiferone B is a daucane sesquiterpene, that can be isolated from Boesenbergia longiflora rhizomes. Longiferone B shows anti-inflammatory activity against NO release with an IC50 of 21.0 μM. Longiferone B also suppresses the iNOS and COX-2 mRNA expression[1].
| Trivial name | Longiferone B |
| Catalog Number | HY-137957 |
| Research Area | Inflammation/Immunology |
| CAS# | 1639810-67-5 |
| Purity | ≥98.00% |
| SMILES | C[C@@]12[C@](CC(C(C)=CC2)=O)([H])[C@@H](CC1)C(C)=C |
| PubChem Chemical Structure ID | 125181476 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/longiferone-b.html |