Ezetimibe
Ezetimibe is a cholesterol-absorption inhibitor, reduces levels of low-density lipoprotein (LDL) cholesterol when added to statin treatment. It’s also a Niemann-Pick C1-like1 (NPC1L1) inhibitor and Nrf2 activator.
| Trivial name | SCH 58235 |
| Catalog Number | CSN12575 |
| Alternative Name(s) | SCH 58235 |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C24H21F2NO3 |
| CAS# | 163222-33-1 |
| Purity | ≥99% |
| SMILES | O=C1N(C2=CC=C(F)C=C2)[C@H](C3=CC=C(O)C=C3)[C@H]1CC[C@@H](C4=CC=C(F)C=C4)O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/ezetimibe.html |