(1R,2R)-1-Aminoindan-2-ol | MedChemExpress (MCE)
(1R,2R)-1-Aminoindan-2-ol is the inactive isomer of (1S,2R)-1-Aminoindan-2-ol (HY-W002530), and can be used as an experimental control. (1S,2R)-1-Amino-2,3-dihydro-1H-inden-2-ol is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
| Trivial name | (1R,2R)-1-Aminoindan-2-ol |
| Catalog Number | HY-W002530A |
| Research Area | Others |
| CAS# | 163061-73-2 |
| Purity | ≥98.00% |
| SMILES | O[C@H]1[C@@H](C2=C(C1)C=CC=C2)N |
| PubChem Chemical Structure ID | 6931154 |
| Size | 1 g |
| Supplier Page | https://www.medchemexpress.com/1r-2r-1-aminoindan-2-ol.html |