LP-6 | MedChemExpress (MCE)
LP-6 is a Drug-Linker Conjugates for ADC, and can be used for synthesis of ADCs. LP-6 consists of an Eg5 inhibitor and a linker[1].
| Trivial name | LP-6 |
| Catalog Number | HY-157079 |
| Research Area | Cancer |
| CAS# | 1629736-79-3 |
| Purity | ≥98.00% |
| SMILES | CC([C@H](C1=NC(C2=CC(F)=CC=C2F)=CN1CC3=CC=CC=C3)N(C[C@H]4[C@H](CNC4)F)C([C@@H](O)C)=O)(CC(NCCN5C(C=CC5=O)=O)=O)C |
| PubChem Chemical Structure ID | 117609134 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lp-6.html |