Maytansinoid B | MedChemExpress (MCE)
Maytansinoid B is a kind of ADC Cytotoxin. Maytansinoid B can be used to conjugates with antibodies to form antibody-drug conjugates (ADCs). Maytansinoids are known as antimitotic agents, binding to tubulin and inhibiting microtubule assembly. Maytansinoids induces G2/M arrest in the cell cycle to induce apoptosis[1][2].
Trivial name | Maytansinoid B |
Catalog Number | HY-148870 |
Research Area | Cancer |
CAS# | 1628543-40-7 |
Purity | ≥98.00% |
SMILES | O=C(N(C)[C@@H](C)C(O[C@H]([C@@]1(C)[C@@H](O1)[C@@H]2C)CC(N(C)C3=C(Cl)C(OC)=CC(C/C(C)=C/C=C/[C@@H](OC)[C@]4(O)NC(O[C@H]2C4)=O)=C3)=O)=O)CCNC |
PubChem Chemical Structure ID | 166642642 |
Size | 25 mg |
Supplier Page | https://www.medchemexpress.com/maytansinoid-b.html |