PFI-2 25mg
PFI-2 is a potent, selective, and cell-active lysine methyltransferase SETD7 inhibitor with Ki (app) and IC50 of 0.33 nM and 2 nM, 1000-fold selectivity over other methyltransferases and other non-epigenetic targets.
| Trivial name | PFI-2 25mg |
| Catalog Number | A14216-25 |
| Alternative Name(s) | 8-fluoro-1,2,3,4-tetrahydro-N-[(1R)-2-oxo-2-(1-pyrrolidinyl)-1-[[3-(trifluoromethyl)phenyl]methyl]ethyl]-6-isoquinolinesulfonamide |
| Molecular Formula | C23H25F4N3O3S |
| CAS# | 1627676-59-8 |
| SMILES | C1CCN(C1)C(=O)[C@@H](CC2=CC(=CC=C2)C(F)(F)F)NS(=O)(=O)C3=CC(=C4CNCCC4=C3)F |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/pfi-2.html |
