WAY-100635 10mg
WAY-100635 was originally believed to act as a selective 5-HT1A receptor antagonist, but subsequent research showed that it also acts as potent full agonist at the D4 receptor.
| Trivial name | WAY-100635 10mg |
| Catalog Number | A11182-10 |
| Alternative Name(s) | N-[2-[4-(2-methoxyphenyl)-1-piperazinyl]ethyl]- N-(2-pyridyl)cyclohexanecarboxamide |
| Molecular Formula | C25H34N4O2 |
| CAS# | 162760-96-5 |
| SMILES | COC1=CC=CC=C1N2CCN(CC2)CCN(C3=CC=CC=N3)C(=O)C4CCCCC4 |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/way-100635.html |
