Kaempferol Tetraacetate
Kaempferol tetraacetate, a natural product isolated and purified from the herbs of Cudrania tricuspidata, exhibits significant cytotoxicity in vitro against three human cell lines HL-60, U937 and SK-MEL-1, and is a potent antiplatelet agent.
| Trivial name | / |
| Catalog Number | CSN13247 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C23H18O10 |
| CAS# | 16274-11-6 |
| Purity | ≥98% |
| SMILES | O=C1C(OC(C)=O)=C(C2=CC=C(OC(C)=O)C=C2)OC3=C1C(OC(C)=O)=CC(OC(C)=O)=C3 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/kaempferol-tetraacetate.html |