Elinafide | MedChemExpress (MCE)
Elinafide is an anticancer agent with a naphthalimide structure that targets DNA. Elinafide interferes with cell metabolism by inserting a planar ring into the DNA double helix and interacting with enzymes through its side chain. The IC50 value of Elinafide for HT-29 cells is 0.014 μM[1].
| Trivial name | Elinafide |
| Catalog Number | HY-13620 |
| Alternative Name(s) | LU 79553 |
| Research Area | Cancer |
| CAS# | 162706-37-8 |
| Purity | 98.6% |
| SMILES | O=C1N(CCNCCCNCCN(C(C2=CC=CC3=CC=CC4=C23)=O)C4=O)C(C5=CC=CC6=CC=CC1=C56)=O |
| Size | 50 mg |
| Supplier Page | https://www.medchemexpress.com/elinafide.html |