Zorifertinib hydrochloride | MedChemExpress (MCE)
Zorifertinib (AZD3759) hydrochloride is a potent, orally active, central nervous system-penetrant, EGFR inhibitor (IC50s: 0.3, 0.2, and 0.2 nM for EGFRwt, EGFRL858R, and EGFRexon 19Del, respectively). Zorifertinib hydrochloride induces cancer cell apoptosis. Zorifertinib hydrochloride has antitumor activity, and can be used for NSCLC, HCC etc. research[1][2].
| Trivial name | Zorifertinib hydrochloride |
| Catalog Number | HY-18750A |
| Alternative Name(s) | AZD3759 hydrochloride |
| Research Area | Cancer |
| CAS# | 1626387-81-2 |
| Purity | ≥98.00% |
| SMILES | ClC1=CC=CC(NC2=NC=NC3=CC(OC)=C(OC(N4[C@H](C)CN(C)CC4)=O)C=C23)=C1F.Cl |
| PubChem Chemical Structure ID | 78322366 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/zorifertinib-hydrochloride.html |