MCAAD-3 | MedChemExpress (MCE)
MCAAD-3 is a near-infrared Aβ imaging probe with blood-brain barrier penetrability. MCAAD-3 has a strong affinity for Aβ polymers (Ki >106 nM) and can label Aβ plaques in the brains of transgenic mice[1].
| Trivial name | MCAAD-3 |
| Catalog Number | HY-156842 |
| Research Area | Neurological Disease |
| CAS# | 1625629-51-7 |
| Purity | ≥98.00% |
| SMILES | CN(C1=CC=C(C=C1)/C=C/C=C/C=C(C#N)/C(OC)=O)C |
| PubChem Chemical Structure ID | 168286603 |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/mcaad-3.html |