Medroxyprogesterone D3
Marine
| Trivial name | NULL |
| Catalog Number | CS-O-06750 |
| Alternative Name(s) | (1S,2R,8S,10R,11S,14R,15S)-1,15-dimethylte.0¹¹,¹5]heptadec-6-en-5-one |
| Research Area | Labeled progesterone, intended for use as an internal standard for the quantification of progesterone by GC- or LC-mass spectrometry. |
| Molecular Formula | C22H29O3D3 |
| CAS# | 162462-69-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]1([C@@]2(O)C(C)=O)[C@](CC2)([H])[C@@](C[C@H](C([2H])([2H])[2H])C3=CC4=O)([H])[C@]([C@]3(CC4)C)([H])CC1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06750.html |
| Additional Information | NULL |