FTY720 (Fingolimod) 10mM * 1mL in DMSO
FTY720 is a derivative of ISP-1 (myriocin), a fungal metabolite of the Chinese herb Iscaria sinclarii as well as a structural analog of sphingosine.
Trivial name | FTY720 (Fingolimod) 10mM * 1mL in DMSO |
Catalog Number | A10408-10mM-D |
Alternative Name(s) | 2-amino-2[2-(4-octylphenyl)ethy-1]-1,3 propanediol hydrochloride |
Molecular Formula | C19H33NO2.HCl |
CAS# | 162359-56-0 |
SMILES | CCCCCCCCC1=CC=C(C=C1)CCC(CO)(CO)N.Cl |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/fty720-fingolimod.html |