(2R)-Glycerol-O-β-D-galactopyranoside
(2R)-Glycerol-O-β-D-galactopyranoside is a substrate for β-galactosidase, the lactose repressor, the galactose-binding protein, and the β-methylgalactoside transport system. It also serves as a substrate for the third lac operon encoded enzyme, thiogalactoside transacetylase.
| Catalog Number | T36835 |
| Molecular Formula | C9H18O8 |
| CAS# | 16232-91-0 |
| SMILES | O(C[C@@H](CO)O)[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| Size | 5 mg |
| Supplier Page | https://www.targetmol.com/compound/(2r)-glycerol-o-β-d-galactopyranoside |
| Additional Information | https://www.targetmol.com/datasheet/T36835 |