Biphenyl-4-sulfonyl Chloride
Biphenyl-4-sulfonyl chloride is an inhibitor of HDAC and it has synthetic applications in palladium-catalyzed desulfitative C-arylation.
| Trivial name | p-Phenylbenzenesulfonyl chloride; 4-Phenylbenzenesulfonyl chloride; p-Biphenylsulfonyl chloride |
| Catalog Number | CSN21754 |
| Alternative Name(s) | p-Phenylbenzenesulfonyl chloride; 4-Phenylbenzenesulfonyl chloride; p-Biphenylsulfonyl chloride |
| Research Area | / |
| Molecular Formula | C12H9ClO2S |
| CAS# | 1623-93-4 |
| Purity | ≥98% |
| SMILES | O=S(C1=CC=C(C2=CC=CC=C2)C=C1)(Cl)=O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/biphenyl-4-sulfonyl-chloride.html |
