R110 azide, 6-isomer | MedChemExpress (MCE)
R110 azide, 6-isomer is an isomer of rhodamine dye with an azide group that labels DNA fragments. It enables visualization of the results of capillary electrophoresis genotyping experiments and gel shift experiments.
| Trivial name | R110 azide, 6-isomer |
| Catalog Number | HY-D1311 |
| CAS# | 1622395-29-2 |
| Purity | ≥98.0% |
| SMILES | [N-]=[N+]=NCCCNC(C1=CC=C2C(OC3(C2=C1)C4=CC=C(C=C4OC5=CC(N)=CC=C53)N)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/r110-azide-6-isomer.html |