Allopurinol Riboside
Allopurinol riboside, a structural isomer of hypoxanthine, is a naturally occurring purine in the body. It is also an enzyme inhibitor of xanthine oxidase and an anti-leishmanial agent.
| Trivial name | / |
| Catalog Number | CSN21467 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C10H12N4O5 |
| CAS# | 16220-07-8 |
| Purity | ≥98% |
| SMILES | O=C1C2=C(N([C@H]3[C@@H]([C@@H]([C@@H](CO)O3)O)O)N=C2)N=CN1 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/allopurinol-riboside.html |