8-Iso-15-keto prostaglandin F2β | MedChemExpress (MCE)
8-ISo-15-keto prostaglandin F2β is a potential metabolite of 8-Iso PGF2β via the 15-hydroxy-PG dehydrogenase pathway. 8-iso PGF2β constricts pulmonary veins in dogs and pigs[1][2].
| Trivial name | 8-Iso-15-keto prostaglandin F2β |
| Catalog Number | HY-116591 |
| Research Area | Endocrinology |
| CAS# | 1621482-36-7 |
| Purity | ≥98.0% |
| SMILES | OC(CCC/C=C\C[C@H]1[C@H]([C@@H](C[C@H]1O)O)/C=C/C(CCCCC)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/8-iso-15-keto-prostaglandin-f2β.html |